C17H31NO — CID 144515518
(3Z,8E)-1-ethyl-7-methoxy-3-methyl-1-azacyclotetradeca-3,8-diene (PubChem CID 144515518) has the molecular formula C17H31NO and a molecular weight of 265.44 g/mol. Its IUPAC name is (3Z,8E)-1-ethyl-7-methoxy-3-methyl-1-azacyclotetradeca-3,8-diene.
| Compound Name | (3Z,8E)-1-ethyl-7-methoxy-3-methyl-1-azacyclotetradeca-3,8-diene |
|---|---|
| PubChem CID | 144515518 |
| Molecular Formula | C17H31NO |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.24 |
| IUPAC Name | (3Z,8E)-1-ethyl-7-methoxy-3-methyl-1-azacyclotetradeca-3,8-diene |
| SMILES | CCN1CCCCC/C=C/C(OC)CC/C=C(/C)C1 |
| InChI | InChI=1S/C17H31NO/c1-4-18-14-9-7-5-6-8-12-17(19-3)13-10-11-16(2)15-18/h8,11-12,17H,4-7,9-10,13-15H2,1-3H3/b12-8+,16-11- |
| InChIKey | IYOVNRVYYRQOOM-VRDXCEGKSA-N |
| XLogP | 4.18 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|