C15H27NO — CID 144515525
(3Z,8E)-7-methoxy-3-methyl-1-azacyclotetradeca-3,8-diene (PubChem CID 144515525) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is (3Z,8E)-7-methoxy-3-methyl-1-azacyclotetradeca-3,8-diene.
| Compound Name | (3Z,8E)-7-methoxy-3-methyl-1-azacyclotetradeca-3,8-diene |
|---|---|
| PubChem CID | 144515525 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | (3Z,8E)-7-methoxy-3-methyl-1-azacyclotetradeca-3,8-diene |
| SMILES | COC1/C=C/CCCCCNC/C(C)=C\CC1 |
| InChI | InChI=1S/C15H27NO/c1-14-9-8-11-15(17-2)10-6-4-3-5-7-12-16-13-14/h6,9-10,15-16H,3-5,7-8,11-13H2,1-2H3/b10-6+,14-9- |
| InChIKey | LJVHKIVCMKFWFW-QIXAWMBPSA-N |
| XLogP | 3.45 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|