C16H29NO — CID 144515557
(3Z,8E)-7-methoxy-1,3-dimethyl-1-azacyclotetradeca-3,8-diene (PubChem CID 144515557) has the molecular formula C16H29NO and a molecular weight of 251.41 g/mol. Its IUPAC name is (3Z,8E)-7-methoxy-1,3-dimethyl-1-azacyclotetradeca-3,8-diene.
| Compound Name | (3Z,8E)-7-methoxy-1,3-dimethyl-1-azacyclotetradeca-3,8-diene |
|---|---|
| PubChem CID | 144515557 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | (3Z,8E)-7-methoxy-1,3-dimethyl-1-azacyclotetradeca-3,8-diene |
| SMILES | COC1/C=C/CCCCCN(C)C/C(C)=C\CC1 |
| InChI | InChI=1S/C16H29NO/c1-15-10-9-12-16(18-3)11-7-5-4-6-8-13-17(2)14-15/h7,10-11,16H,4-6,8-9,12-14H2,1-3H3/b11-7+,15-10- |
| InChIKey | ZEMKWWOJGUSMAU-OVJOMLMPSA-N |
| XLogP | 3.79 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|