C11H21NO — CID 134900687
(1S,4R)-N,N-diethyl-4-methoxycyclohex-2-en-1-amine (PubChem CID 134900687) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is (1S,4R)-N,N-diethyl-4-methoxycyclohex-2-en-1-amine.
| Compound Name | (1S,4R)-N,N-diethyl-4-methoxycyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 134900687 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | (1S,4R)-N,N-diethyl-4-methoxycyclohex-2-en-1-amine |
| SMILES | CCN(CC)[C@@H]1C=C[C@H](OC)CC1 |
| InChI | InChI=1S/C11H21NO/c1-4-12(5-2)10-6-8-11(13-3)9-7-10/h6,8,10-11H,4-5,7,9H2,1-3H3/t10-,11+/m1/s1 |
| InChIKey | IODKKMISAPRBGU-MNOVXSKESA-N |
| XLogP | 2.06 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|