C23H41NO — CID 142550059
(2E)-N-heptyl-N-[(2E,4Z)-6-methoxyhepta-2,4-dien-3-yl]-2-methylhepta-2,6-dien-1-amine (PubChem CID 142550059) has the molecular formula C23H41NO and a molecular weight of 347.59 g/mol. Its IUPAC name is (2E)-N-heptyl-N-[(2E,4Z)-6-methoxyhepta-2,4-dien-3-yl]-2-methylhepta-2,6-dien-1-amine.
| Compound Name | (2E)-N-heptyl-N-[(2E,4Z)-6-methoxyhepta-2,4-dien-3-yl]-2-methylhepta-2,6-dien-1-amine |
|---|---|
| PubChem CID | 142550059 |
| Molecular Formula | C23H41NO |
| Molecular Weight | 347.59 g/mol |
| Exact Mass | 347.32 |
| IUPAC Name | (2E)-N-heptyl-N-[(2E,4Z)-6-methoxyhepta-2,4-dien-3-yl]-2-methylhepta-2,6-dien-1-amine |
| SMILES | C=CCC/C=C(\C)CN(CCCCCCC)C(/C=C\C(C)OC)=C/C |
| InChI | InChI=1S/C23H41NO/c1-7-10-12-13-15-19-24(20-21(4)16-14-11-8-2)23(9-3)18-17-22(5)25-6/h8-9,16-18,22H,2,7,10-15,19-20H2,1,3-6H3/b18-17-,21-16+,23-9+ |
| InChIKey | FPDPSNRKPAHZHU-QYRWSAIFSA-N |
| XLogP | 6.67 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.59 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|