C22H39NO — CID 138519709
N-(3,7-dimethyloct-6-enyl)-N-(2,2-dimethylpropyl)-4-methoxycyclohexa-1,5-dien-1-amine (PubChem CID 138519709) has the molecular formula C22H39NO and a molecular weight of 333.56 g/mol. Its IUPAC name is N-(3,7-dimethyloct-6-enyl)-N-(2,2-dimethylpropyl)-4-methoxycyclohexa-1,5-dien-1-amine.
| Compound Name | N-(3,7-dimethyloct-6-enyl)-N-(2,2-dimethylpropyl)-4-methoxycyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 138519709 |
| Molecular Formula | C22H39NO |
| Molecular Weight | 333.56 g/mol |
| Exact Mass | 333.30 |
| IUPAC Name | N-(3,7-dimethyloct-6-enyl)-N-(2,2-dimethylpropyl)-4-methoxycyclohexa-1,5-dien-1-amine |
| SMILES | COC1C=CC(N(CCC(C)CCC=C(C)C)CC(C)(C)C)=CC1 |
| InChI | InChI=1S/C22H39NO/c1-18(2)9-8-10-19(3)15-16-23(17-22(4,5)6)20-11-13-21(24-7)14-12-20/h9,11-13,19,21H,8,10,14-17H2,1-7H3 |
| InChIKey | NAAWHPPPHNSULM-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.56 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|