C23H37NO — CID 123441839
1-(5-methoxy-6-methyl-3-prop-1-en-2-yldodeca-1,3,5-trien-2-yl)-2-methyl-4-methylidenepyrrolidine (PubChem CID 123441839) has the molecular formula C23H37NO and a molecular weight of 343.56 g/mol. Its IUPAC name is 1-(5-methoxy-6-methyl-3-prop-1-en-2-yldodeca-1,3,5-trien-2-yl)-2-methyl-4-methylidenepyrrolidine.
| Compound Name | 1-(5-methoxy-6-methyl-3-prop-1-en-2-yldodeca-1,3,5-trien-2-yl)-2-methyl-4-methylidenepyrrolidine |
|---|---|
| PubChem CID | 123441839 |
| Molecular Formula | C23H37NO |
| Molecular Weight | 343.56 g/mol |
| Exact Mass | 343.29 |
| IUPAC Name | 1-(5-methoxy-6-methyl-3-prop-1-en-2-yldodeca-1,3,5-trien-2-yl)-2-methyl-4-methylidenepyrrolidine |
| SMILES | C=C1CC(C)N(C(=C)C(=CC(OC)=C(C)CCCCCC)C(=C)C)C1 |
| InChI | InChI=1S/C23H37NO/c1-9-10-11-12-13-19(5)23(25-8)15-22(17(2)3)21(7)24-16-18(4)14-20(24)6/h15,20H,2,4,7,9-14,16H2,1,3,5-6,8H3 |
| InChIKey | AKMGFWVIZNOZAY-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.56 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|