C16H23NO — CID 162524709
5-ethenyl-4-[(3E,5E)-5-methoxy-2-methylhepta-1,3,5-trien-3-yl]-1-methyl-2,3-dihydropyrrole (PubChem CID 162524709) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is 5-ethenyl-4-[(3E,5E)-5-methoxy-2-methylhepta-1,3,5-trien-3-yl]-1-methyl-2,3-dihydropyrrole.
| Compound Name | 5-ethenyl-4-[(3E,5E)-5-methoxy-2-methylhepta-1,3,5-trien-3-yl]-1-methyl-2,3-dihydropyrrole |
|---|---|
| PubChem CID | 162524709 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | 5-ethenyl-4-[(3E,5E)-5-methoxy-2-methylhepta-1,3,5-trien-3-yl]-1-methyl-2,3-dihydropyrrole |
| SMILES | C=CC1=C(/C(=C/C(=C\C)OC)C(=C)C)CCN1C |
| InChI | InChI=1S/C16H23NO/c1-7-13(18-6)11-15(12(3)4)14-9-10-17(5)16(14)8-2/h7-8,11H,2-3,9-10H2,1,4-6H3/b13-7+,15-11+ |
| InChIKey | FAKVYIWVZLPOHC-SWZCAMMWSA-N |
| XLogP | 3.81 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|