C15H25NO — CID 123630450
2-methoxy-N,N,4,8-tetramethyl-7-methylidenenona-1,3,8-trien-5-amine (PubChem CID 123630450) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is 2-methoxy-N,N,4,8-tetramethyl-7-methylidenenona-1,3,8-trien-5-amine.
| Compound Name | 2-methoxy-N,N,4,8-tetramethyl-7-methylidenenona-1,3,8-trien-5-amine |
|---|---|
| PubChem CID | 123630450 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 2-methoxy-N,N,4,8-tetramethyl-7-methylidenenona-1,3,8-trien-5-amine |
| SMILES | C=C(C=C(C)C(CC(=C)C(=C)C)N(C)C)OC |
| InChI | InChI=1S/C15H25NO/c1-11(2)12(3)10-15(16(6)7)13(4)9-14(5)17-8/h9,15H,1,3,5,10H2,2,4,6-8H3 |
| InChIKey | NVOSRLYOQNDGHK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|