C22H31NO — CID 142044157
2-cyclohepta-1,4,6-trien-1-yl-1-[(2Z)-2-[(E)-1-methoxyprop-1-enyl]-4-methylpenta-2,4-dienyl]piperidine (PubChem CID 142044157) has the molecular formula C22H31NO and a molecular weight of 325.50 g/mol. Its IUPAC name is 2-cyclohepta-1,4,6-trien-1-yl-1-[(2Z)-2-[(E)-1-methoxyprop-1-enyl]-4-methylpenta-2,4-dienyl]piperidine.
| Compound Name | 2-cyclohepta-1,4,6-trien-1-yl-1-[(2Z)-2-[(E)-1-methoxyprop-1-enyl]-4-methylpenta-2,4-dienyl]piperidine |
|---|---|
| PubChem CID | 142044157 |
| Molecular Formula | C22H31NO |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | 2-cyclohepta-1,4,6-trien-1-yl-1-[(2Z)-2-[(E)-1-methoxyprop-1-enyl]-4-methylpenta-2,4-dienyl]piperidine |
| SMILES | C=C(C)/C=C(CN1CCCCC1C1=CCC=CC=C1)\C(=C/C)OC |
| InChI | InChI=1S/C22H31NO/c1-5-22(24-4)20(16-18(2)3)17-23-15-11-10-14-21(23)19-12-8-6-7-9-13-19/h5-8,12-13,16,21H,2,9-11,14-15,17H2,1,3-4H3/b20-16-,22-5+ |
| InChIKey | ASBKZOIAGGPBRL-NRILDKPUSA-N |
| XLogP | 5.34 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|