About 11-oxa-2-azatricyclo[6.3.1.02,7]dodeca-8(12),9-diene
11-oxa-2-azatricyclo[6.3.1.02,7]dodeca-8(12),9-diene (PubChem CID 141000195) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is 11-oxa-2-azatricyclo[6.3.1.02,7]dodeca-8(12),9-diene.
Analyze 11-oxa-2-azatricyclo[6.3.1.02,7]dodeca-8(12),9-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-oxa-2-azatricyclo[6.3.1.02,7]dodeca-8(12),9-diene?
The IUPAC name of 11-oxa-2-azatricyclo[6.3.1.02,7]dodeca-8(12),9-diene (CID 141000195) is 11-oxa-2-azatricyclo[6.3.1.02,7]dodeca-8(12),9-diene.
What is the SMILES notation for 11-oxa-2-azatricyclo[6.3.1.02,7]dodeca-8(12),9-diene?
The canonical SMILES for 11-oxa-2-azatricyclo[6.3.1.02,7]dodeca-8(12),9-diene is C1=CC2=CC(O1)N1CCCCC21.
What is the InChIKey of 11-oxa-2-azatricyclo[6.3.1.02,7]dodeca-8(12),9-diene?
The InChIKey is NXRQKZDMTHEMCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO/c1-2-5-11-9(3-1)8-4-6-12-10(11)7-8/h4,6-7,9-10H,1-3,5H2.
What are the key properties of 11-oxa-2-azatricyclo[6.3.1.02,7]dodeca-8(12),9-diene?
11-oxa-2-azatricyclo[6.3.1.02,7]dodeca-8(12),9-diene has a molecular weight of 163.22 g/mol, XLogP of 1.65, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 11-oxa-2-azatricyclo[6.3.1.02,7]dodeca-8(12),9-diene is sourced from PubChem (CID 141000195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).