C16H31NO — CID 142549969
(Z,2E)-N-ethyl-2-ethylidene-N-hexan-2-yl-5-methoxypent-3-en-1-amine (PubChem CID 142549969) has the molecular formula C16H31NO and a molecular weight of 253.43 g/mol. Its IUPAC name is (Z,2E)-N-ethyl-2-ethylidene-N-hexan-2-yl-5-methoxypent-3-en-1-amine.
| Compound Name | (Z,2E)-N-ethyl-2-ethylidene-N-hexan-2-yl-5-methoxypent-3-en-1-amine |
|---|---|
| PubChem CID | 142549969 |
| Molecular Formula | C16H31NO |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.24 |
| IUPAC Name | (Z,2E)-N-ethyl-2-ethylidene-N-hexan-2-yl-5-methoxypent-3-en-1-amine |
| SMILES | C/C=C(\C=C/COC)CN(CC)C(C)CCCC |
| InChI | InChI=1S/C16H31NO/c1-6-9-11-15(4)17(8-3)14-16(7-2)12-10-13-18-5/h7,10,12,15H,6,8-9,11,13-14H2,1-5H3/b12-10-,16-7+ |
| InChIKey | HATGLXUOBVLBAP-SQXPJVNCSA-N |
| XLogP | 4.04 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|