C16H30NO+ — CID 142241501
triethyl-[(2E,4Z)-6-(methoxymethyl)-2-methylhepta-2,4,6-trienyl]azanium (PubChem CID 142241501) has the molecular formula C16H30NO+ and a molecular weight of 252.42 g/mol. Its IUPAC name is triethyl-[(2E,4Z)-6-(methoxymethyl)-2-methylhepta-2,4,6-trienyl]azanium.
| Compound Name | triethyl-[(2E,4Z)-6-(methoxymethyl)-2-methylhepta-2,4,6-trienyl]azanium |
|---|---|
| PubChem CID | 142241501 |
| Molecular Formula | C16H30NO+ |
| Molecular Weight | 252.42 g/mol |
| Exact Mass | 252.23 |
| IUPAC Name | triethyl-[(2E,4Z)-6-(methoxymethyl)-2-methylhepta-2,4,6-trienyl]azanium |
| SMILES | C=C(/C=C\C=C(/C)C[N+](CC)(CC)CC)COC |
| InChI | InChI=1S/C16H30NO/c1-7-17(8-2,9-3)13-15(4)11-10-12-16(5)14-18-6/h10-12H,5,7-9,13-14H2,1-4,6H3/q+1/b12-10-,15-11+ |
| InChIKey | YWHZEBJBLVTWMA-MOPKJALQSA-N |
| XLogP | 3.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|