C17H35NO — CID 143996936
ethane;(2E,4E)-N-ethyl-N-methyl-2-[(E)-prop-1-enyl]hexa-2,4-dien-1-amine;methoxyethane (PubChem CID 143996936) has the molecular formula C17H35NO and a molecular weight of 269.47 g/mol. Its IUPAC name is ethane;(2E,4E)-N-ethyl-N-methyl-2-[(E)-prop-1-enyl]hexa-2,4-dien-1-amine;methoxyethane.
| Compound Name | ethane;(2E,4E)-N-ethyl-N-methyl-2-[(E)-prop-1-enyl]hexa-2,4-dien-1-amine;methoxyethane |
|---|---|
| PubChem CID | 143996936 |
| Molecular Formula | C17H35NO |
| Molecular Weight | 269.47 g/mol |
| Exact Mass | 269.27 |
| IUPAC Name | ethane;(2E,4E)-N-ethyl-N-methyl-2-[(E)-prop-1-enyl]hexa-2,4-dien-1-amine;methoxyethane |
| SMILES | C/C=C/C=C(\C=C\C)CN(C)CC.CC.CCOC |
| InChI | InChI=1S/C12H21N.C3H8O.C2H6/c1-5-8-10-12(9-6-2)11-13(4)7-3;1-3-4-2;1-2/h5-6,8-10H,7,11H2,1-4H3;3H2,1-2H3;1-2H3/b8-5+,9-6+,12-10+;; |
| InChIKey | JLJAKCAMCRKCIF-MRPGNYFJSA-N |
| XLogP | 4.70 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.47 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|