C19H35NO — CID 142550153
(Z,2E)-N-butyl-2-ethylidene-N-[(E)-prop-1-enyl]hex-3-en-1-amine;3-methoxyprop-1-ene (PubChem CID 142550153) has the molecular formula C19H35NO and a molecular weight of 293.50 g/mol. Its IUPAC name is (Z,2E)-N-butyl-2-ethylidene-N-[(E)-prop-1-enyl]hex-3-en-1-amine;3-methoxyprop-1-ene.
| Compound Name | (Z,2E)-N-butyl-2-ethylidene-N-[(E)-prop-1-enyl]hex-3-en-1-amine;3-methoxyprop-1-ene |
|---|---|
| PubChem CID | 142550153 |
| Molecular Formula | C19H35NO |
| Molecular Weight | 293.50 g/mol |
| Exact Mass | 293.27 |
| IUPAC Name | (Z,2E)-N-butyl-2-ethylidene-N-[(E)-prop-1-enyl]hex-3-en-1-amine;3-methoxyprop-1-ene |
| SMILES | C/C=C/N(CCCC)CC(/C=C\CC)=C/C.C=CCOC |
| InChI | InChI=1S/C15H27N.C4H8O/c1-5-9-11-15(8-4)14-16(12-7-3)13-10-6-2;1-3-4-5-2/h7-9,11-12H,5-6,10,13-14H2,1-4H3;3H,1,4H2,2H3/b11-9-,12-7+,15-8+; |
| InChIKey | QXIFJIJNKLBBST-IITGLXSXSA-N |
| XLogP | 5.35 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.50 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|