C10H19NO — CID 143678092
ethane;2-methoxy-1,5-dimethyl-2H-pyridine (PubChem CID 143678092) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is ethane;2-methoxy-1,5-dimethyl-2H-pyridine.
| Compound Name | ethane;2-methoxy-1,5-dimethyl-2H-pyridine |
|---|---|
| PubChem CID | 143678092 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | ethane;2-methoxy-1,5-dimethyl-2H-pyridine |
| SMILES | CC.COC1C=CC(C)=CN1C |
| InChI | InChI=1S/C8H13NO.C2H6/c1-7-4-5-8(10-3)9(2)6-7;1-2/h4-6,8H,1-3H3;1-2H3 |
| InChIKey | LBCBJXBMLAMSND-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |