C14H22LiNO — CID 138968244
lithium N,N-dimethyl-1-[3-[(2-methylpropan-2-yl)oxymethyl]benzene-2-id-1-yl]methanamine (PubChem CID 138968244) has the molecular formula C14H22LiNO and a molecular weight of 227.28 g/mol. Its IUPAC name is lithium N,N-dimethyl-1-[3-[(2-methylpropan-2-yl)oxymethyl]benzene-2-id-1-yl]methanamine.
| Compound Name | lithium N,N-dimethyl-1-[3-[(2-methylpropan-2-yl)oxymethyl]benzene-2-id-1-yl]methanamine |
|---|---|
| PubChem CID | 138968244 |
| Molecular Formula | C14H22LiNO |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | lithium N,N-dimethyl-1-[3-[(2-methylpropan-2-yl)oxymethyl]benzene-2-id-1-yl]methanamine |
| SMILES | CN(C)Cc1[c-]c(COC(C)(C)C)ccc1.[Li+] |
| InChI | InChI=1S/C14H22NO.Li/c1-14(2,3)16-11-13-8-6-7-12(9-13)10-15(4)5;/h6-8H,10-11H2,1-5H3;/q-1;+1 |
| InChIKey | OKUZGRLNVZKUSA-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|