C13H23NO — CID 142169632
N,N-dimethyl-3-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]oxypropan-1-amine (PubChem CID 142169632) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is N,N-dimethyl-3-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]oxypropan-1-amine.
| Compound Name | N,N-dimethyl-3-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]oxypropan-1-amine |
|---|---|
| PubChem CID | 142169632 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | N,N-dimethyl-3-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]oxypropan-1-amine |
| SMILES | C=C(C)/C=C\C(=C/C)OCCCN(C)C |
| InChI | InChI=1S/C13H23NO/c1-6-13(9-8-12(2)3)15-11-7-10-14(4)5/h6,8-9H,2,7,10-11H2,1,3-5H3/b9-8-,13-6+ |
| InChIKey | KGMDLZNDTFCXNT-GFBXJKNCSA-N |
| XLogP | 2.99 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|