C11H19NO — CID 18470682
3-cyclohexa-1,5-dien-1-yloxy-N,N-dimethylpropan-1-amine (PubChem CID 18470682) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 3-cyclohexa-1,5-dien-1-yloxy-N,N-dimethylpropan-1-amine.
| Compound Name | 3-cyclohexa-1,5-dien-1-yloxy-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 18470682 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 3-cyclohexa-1,5-dien-1-yloxy-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCOC1=CCCC=C1 |
| InChI | InChI=1S/C11H19NO/c1-12(2)9-6-10-13-11-7-4-3-5-8-11/h4,7-8H,3,5-6,9-10H2,1-2H3 |
| InChIKey | SNKCLFDVMTVIGO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|