C14H24FNO — CID 143263466
N-ethyl-3-(5-fluoro-2-methylcyclohepta-1,6-dien-1-yl)oxy-N-methylpropan-1-amine (PubChem CID 143263466) has the molecular formula C14H24FNO and a molecular weight of 241.35 g/mol. Its IUPAC name is N-ethyl-3-(5-fluoro-2-methylcyclohepta-1,6-dien-1-yl)oxy-N-methylpropan-1-amine.
| Compound Name | N-ethyl-3-(5-fluoro-2-methylcyclohepta-1,6-dien-1-yl)oxy-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 143263466 |
| Molecular Formula | C14H24FNO |
| Molecular Weight | 241.35 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | N-ethyl-3-(5-fluoro-2-methylcyclohepta-1,6-dien-1-yl)oxy-N-methylpropan-1-amine |
| SMILES | CCN(C)CCCOC1=C(C)CCC(F)C=C1 |
| InChI | InChI=1S/C14H24FNO/c1-4-16(3)10-5-11-17-14-9-8-13(15)7-6-12(14)2/h8-9,13H,4-7,10-11H2,1-3H3 |
| InChIKey | IVIVJOGKWPCBJS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|