C14H22FNO — CID 143437546
3-(4-ethyl-7-fluorocyclohepta-1,3,5-trien-1-yl)oxy-N,N-dimethylpropan-1-amine (PubChem CID 143437546) has the molecular formula C14H22FNO and a molecular weight of 239.33 g/mol. Its IUPAC name is 3-(4-ethyl-7-fluorocyclohepta-1,3,5-trien-1-yl)oxy-N,N-dimethylpropan-1-amine.
| Compound Name | 3-(4-ethyl-7-fluorocyclohepta-1,3,5-trien-1-yl)oxy-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 143437546 |
| Molecular Formula | C14H22FNO |
| Molecular Weight | 239.33 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 3-(4-ethyl-7-fluorocyclohepta-1,3,5-trien-1-yl)oxy-N,N-dimethylpropan-1-amine |
| SMILES | CCC1=CC=C(OCCCN(C)C)C(F)C=C1 |
| InChI | InChI=1S/C14H22FNO/c1-4-12-6-8-13(15)14(9-7-12)17-11-5-10-16(2)3/h6-9,13H,4-5,10-11H2,1-3H3 |
| InChIKey | SRNDVPMNUSCJHY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|