C22H30F3NO — CID 142961733
(4E,6Z)-N,N,4,5-tetramethyl-3-[4-(2,2,2-trifluoroethyl)cyclohepta-1,3,6-trien-1-yl]oxynona-4,6,8-trien-1-amine (PubChem CID 142961733) has the molecular formula C22H30F3NO and a molecular weight of 381.48 g/mol. Its IUPAC name is (4E,6Z)-N,N,4,5-tetramethyl-3-[4-(2,2,2-trifluoroethyl)cyclohepta-1,3,6-trien-1-yl]oxynona-4,6,8-trien-1-amine.
| Compound Name | (4E,6Z)-N,N,4,5-tetramethyl-3-[4-(2,2,2-trifluoroethyl)cyclohepta-1,3,6-trien-1-yl]oxynona-4,6,8-trien-1-amine |
|---|---|
| PubChem CID | 142961733 |
| Molecular Formula | C22H30F3NO |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | (4E,6Z)-N,N,4,5-tetramethyl-3-[4-(2,2,2-trifluoroethyl)cyclohepta-1,3,6-trien-1-yl]oxynona-4,6,8-trien-1-amine |
| SMILES | C=C/C=C\C(C)=C(/C)C(CCN(C)C)OC1=CC=C(CC(F)(F)F)CC=C1 |
| InChI | InChI=1S/C22H30F3NO/c1-6-7-9-17(2)18(3)21(14-15-26(4)5)27-20-11-8-10-19(12-13-20)16-22(23,24)25/h6-9,11-13,21H,1,10,14-16H2,2-5H3/b9-7-,18-17+ |
| InChIKey | DNFAOJNEZBAPSS-PGUUPPRWSA-N |
| XLogP | 6.12 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|