C13H20F3NO — CID 166842181
(3Z,4E)-3-ethylidene-6-methoxy-N,N-dimethyl-4-(trifluoromethyl)hepta-4,6-dien-1-amine (PubChem CID 166842181) has the molecular formula C13H20F3NO and a molecular weight of 263.30 g/mol. Its IUPAC name is (3Z,4E)-3-ethylidene-6-methoxy-N,N-dimethyl-4-(trifluoromethyl)hepta-4,6-dien-1-amine.
| Compound Name | (3Z,4E)-3-ethylidene-6-methoxy-N,N-dimethyl-4-(trifluoromethyl)hepta-4,6-dien-1-amine |
|---|---|
| PubChem CID | 166842181 |
| Molecular Formula | C13H20F3NO |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | (3Z,4E)-3-ethylidene-6-methoxy-N,N-dimethyl-4-(trifluoromethyl)hepta-4,6-dien-1-amine |
| SMILES | C=C(/C=C(C(=C/C)\CCN(C)C)/C(F)(F)F)OC |
| InChI | InChI=1S/C13H20F3NO/c1-6-11(7-8-17(3)4)12(13(14,15)16)9-10(2)18-5/h6,9H,2,7-8H2,1,3-5H3/b11-6-,12-9+ |
| InChIKey | RVGFPJSEJWUVSO-PPTLUXDQSA-N |
| XLogP | 3.53 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|