C20H28F3NO2 — CID 143563977
(4E)-4-ethylidene-1-[[(3E,8Z)-7-(trifluoromethoxy)deca-1,3,5,8-tetraen-2-yl]oxymethyl]azepane (PubChem CID 143563977) has the molecular formula C20H28F3NO2 and a molecular weight of 371.44 g/mol. Its IUPAC name is (4E)-4-ethylidene-1-[[(3E,8Z)-7-(trifluoromethoxy)deca-1,3,5,8-tetraen-2-yl]oxymethyl]azepane.
| Compound Name | (4E)-4-ethylidene-1-[[(3E,8Z)-7-(trifluoromethoxy)deca-1,3,5,8-tetraen-2-yl]oxymethyl]azepane |
|---|---|
| PubChem CID | 143563977 |
| Molecular Formula | C20H28F3NO2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | (4E)-4-ethylidene-1-[[(3E,8Z)-7-(trifluoromethoxy)deca-1,3,5,8-tetraen-2-yl]oxymethyl]azepane |
| SMILES | C=C(/C=C/C=CC(/C=C\C)OC(F)(F)F)OCN1CCC/C(=C\C)CC1 |
| InChI | InChI=1S/C20H28F3NO2/c1-4-9-19(26-20(21,22)23)12-7-6-10-17(3)25-16-24-14-8-11-18(5-2)13-15-24/h4-7,9-10,12,19H,3,8,11,13-16H2,1-2H3/b9-4-,10-6+,12-7?,18-5+ |
| InChIKey | GAIJYEWPQJQANS-YDEZYGDWSA-N |
| XLogP | 5.50 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|