C16H26F3NO — CID 143394648
ethane;1-methyl-4-[(2E,4E)-5-(trifluoromethyl)hepta-2,4,6-trien-3-yl]oxypiperidine (PubChem CID 143394648) has the molecular formula C16H26F3NO and a molecular weight of 305.38 g/mol. Its IUPAC name is ethane;1-methyl-4-[(2E,4E)-5-(trifluoromethyl)hepta-2,4,6-trien-3-yl]oxypiperidine.
| Compound Name | ethane;1-methyl-4-[(2E,4E)-5-(trifluoromethyl)hepta-2,4,6-trien-3-yl]oxypiperidine |
|---|---|
| PubChem CID | 143394648 |
| Molecular Formula | C16H26F3NO |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | ethane;1-methyl-4-[(2E,4E)-5-(trifluoromethyl)hepta-2,4,6-trien-3-yl]oxypiperidine |
| SMILES | C=C/C(=C\C(=C/C)OC1CCN(C)CC1)C(F)(F)F.CC |
| InChI | InChI=1S/C14H20F3NO.C2H6/c1-4-11(14(15,16)17)10-12(5-2)19-13-6-8-18(3)9-7-13;1-2/h4-5,10,13H,1,6-9H2,2-3H3;1-2H3/b11-10+,12-5+; |
| InChIKey | HEETTZJTANNMDF-BRGFGOPISA-N |
| XLogP | 4.70 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|