C16H26F3NO — CID 90703251
1-ethyl-4-(2-ethyl-6,6,6-trifluoro-5-methylhexa-2,4-dienoxy)piperidine (PubChem CID 90703251) has the molecular formula C16H26F3NO and a molecular weight of 305.38 g/mol. Its IUPAC name is 1-ethyl-4-(2-ethyl-6,6,6-trifluoro-5-methylhexa-2,4-dienoxy)piperidine.
| Compound Name | 1-ethyl-4-(2-ethyl-6,6,6-trifluoro-5-methylhexa-2,4-dienoxy)piperidine |
|---|---|
| PubChem CID | 90703251 |
| Molecular Formula | C16H26F3NO |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | 1-ethyl-4-(2-ethyl-6,6,6-trifluoro-5-methylhexa-2,4-dienoxy)piperidine |
| SMILES | CCC(=CC=C(C)C(F)(F)F)COC1CCN(CC)CC1 |
| InChI | InChI=1S/C16H26F3NO/c1-4-14(7-6-13(3)16(17,18)19)12-21-15-8-10-20(5-2)11-9-15/h6-7,15H,4-5,8-12H2,1-3H3 |
| InChIKey | XLFYOWPOXYGRIZ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|