C31H61NO — CID 142087467
4-[(3E,6E)-4,6-bis[(Z)-prop-1-enyl]nona-1,3,6,8-tetraen-5-yl]oxy-1-methylpiperidine;ethane (PubChem CID 142087467) has the molecular formula C31H61NO and a molecular weight of 463.84 g/mol. Its IUPAC name is 4-[(3E,6E)-4,6-bis[(Z)-prop-1-enyl]nona-1,3,6,8-tetraen-5-yl]oxy-1-methylpiperidine;ethane.
| Compound Name | 4-[(3E,6E)-4,6-bis[(Z)-prop-1-enyl]nona-1,3,6,8-tetraen-5-yl]oxy-1-methylpiperidine;ethane |
|---|---|
| PubChem CID | 142087467 |
| Molecular Formula | C31H61NO |
| Molecular Weight | 463.84 g/mol |
| Exact Mass | 463.48 |
| IUPAC Name | 4-[(3E,6E)-4,6-bis[(Z)-prop-1-enyl]nona-1,3,6,8-tetraen-5-yl]oxy-1-methylpiperidine;ethane |
| SMILES | C=C/C=C(\C=C/C)C(OC1CCN(C)CC1)C(/C=C\C)=C/C=C.CC.CC.CC.CC.CC |
| InChI | InChI=1S/C21H31NO.5C2H6/c1-6-10-18(11-7-2)21(19(12-8-3)13-9-4)23-20-14-16-22(5)17-15-20;5*1-2/h6-13,20-21H,1,3,14-17H2,2,4-5H3;5*1-2H3/b11-7-,13-9-,18-10+,19-12+;;;;; |
| InChIKey | XLYGSONBYHTSHI-AZKYJXODSA-N |
| XLogP | 9.97 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.84 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|