C34H49NO — CID 122651439
1-[(3Z,5Z)-7-[(2E,4Z)-hepta-2,4-dien-3-yl]oxyocta-3,5-dienyl]-4-[4-[(1E,3Z,5E)-5-methylhepta-1,3,5-trienyl]cyclohexa-1,5-dien-1-yl]piperidine (PubChem CID 122651439) has the molecular formula C34H49NO and a molecular weight of 487.77 g/mol. Its IUPAC name is 1-[(3Z,5Z)-7-[(2E,4Z)-hepta-2,4-dien-3-yl]oxyocta-3,5-dienyl]-4-[4-[(1E,3Z,5E)-5-methylhepta-1,3,5-trienyl]cyclohexa-1,5-dien-1-yl]piperidine.
| Compound Name | 1-[(3Z,5Z)-7-[(2E,4Z)-hepta-2,4-dien-3-yl]oxyocta-3,5-dienyl]-4-[4-[(1E,3Z,5E)-5-methylhepta-1,3,5-trienyl]cyclohexa-1,5-dien-1-yl]piperidine |
|---|---|
| PubChem CID | 122651439 |
| Molecular Formula | C34H49NO |
| Molecular Weight | 487.77 g/mol |
| Exact Mass | 487.38 |
| IUPAC Name | 1-[(3Z,5Z)-7-[(2E,4Z)-hepta-2,4-dien-3-yl]oxyocta-3,5-dienyl]-4-[4-[(1E,3Z,5E)-5-methylhepta-1,3,5-trienyl]cyclohexa-1,5-dien-1-yl]piperidine |
| SMILES | C/C=C(C)/C=C\C=C\C1C=CC(C2CCN(CC/C=C\C=C/C(C)OC(/C=C\CC)=C/C)CC2)=CC1 |
| InChI | InChI=1S/C34H49NO/c1-6-9-19-34(8-3)36-30(5)17-12-10-11-15-26-35-27-24-33(25-28-35)32-22-20-31(21-23-32)18-14-13-16-29(4)7-2/h7-14,16-20,22-23,30-31,33H,6,15,21,24-28H2,1-5H3/b11-10-,16-13-,17-12-,18-14+,19-9-,29-7+,34-8+ |
| InChIKey | RTNPPARQTYMVPK-HINFHYRHSA-N |
| XLogP | 9.06 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.77 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|