C32H41NO — CID 122651438
1-[(3Z,5E)-6-[(1E,3Z)-hexa-1,3,5-trienoxy]-2-methylidenehexa-3,5-dienyl]-4-[(3E,5E,7E,9Z,11E)-11-methyltrideca-1,3,5,7,9,11-hexaen-3-yl]piperidine (PubChem CID 122651438) has the molecular formula C32H41NO and a molecular weight of 455.69 g/mol. Its IUPAC name is 1-[(3Z,5E)-6-[(1E,3Z)-hexa-1,3,5-trienoxy]-2-methylidenehexa-3,5-dienyl]-4-[(3E,5E,7E,9Z,11E)-11-methyltrideca-1,3,5,7,9,11-hexaen-3-yl]piperidine.
| Compound Name | 1-[(3Z,5E)-6-[(1E,3Z)-hexa-1,3,5-trienoxy]-2-methylidenehexa-3,5-dienyl]-4-[(3E,5E,7E,9Z,11E)-11-methyltrideca-1,3,5,7,9,11-hexaen-3-yl]piperidine |
|---|---|
| PubChem CID | 122651438 |
| Molecular Formula | C32H41NO |
| Molecular Weight | 455.69 g/mol |
| Exact Mass | 455.32 |
| IUPAC Name | 1-[(3Z,5E)-6-[(1E,3Z)-hexa-1,3,5-trienoxy]-2-methylidenehexa-3,5-dienyl]-4-[(3E,5E,7E,9Z,11E)-11-methyltrideca-1,3,5,7,9,11-hexaen-3-yl]piperidine |
| SMILES | C=C/C=C\C=C\O/C=C/C=C\C(=C)CN1CCC(/C(C=C)=C/C=C/C=C/C=C\C(C)=C\C)CC1 |
| InChI | InChI=1S/C32H41NO/c1-6-9-10-17-26-34-27-18-16-20-30(5)28-33-24-22-32(23-25-33)31(8-3)21-15-13-11-12-14-19-29(4)7-2/h6-21,26-27,32H,1,3,5,22-25,28H2,2,4H3/b10-9-,12-11+,15-13+,19-14-,20-16-,26-17+,27-18+,29-7+,31-21+ |
| InChIKey | ZFZPPQPFYUUAFJ-IXLNYVQXSA-N |
| XLogP | 8.34 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.69 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|