C18H35NO — CID 170265231
(2E)-3-ethyl-6-methoxy-2-methyl-N-(3-methylbutyl)-N-propylhexa-2,5-dien-1-amine (PubChem CID 170265231) has the molecular formula C18H35NO and a molecular weight of 281.48 g/mol. Its IUPAC name is (2E)-3-ethyl-6-methoxy-2-methyl-N-(3-methylbutyl)-N-propylhexa-2,5-dien-1-amine.
| Compound Name | (2E)-3-ethyl-6-methoxy-2-methyl-N-(3-methylbutyl)-N-propylhexa-2,5-dien-1-amine |
|---|---|
| PubChem CID | 170265231 |
| Molecular Formula | C18H35NO |
| Molecular Weight | 281.48 g/mol |
| Exact Mass | 281.27 |
| IUPAC Name | (2E)-3-ethyl-6-methoxy-2-methyl-N-(3-methylbutyl)-N-propylhexa-2,5-dien-1-amine |
| SMILES | CCCN(CCC(C)C)C/C(C)=C(\CC)CC=COC |
| InChI | InChI=1S/C18H35NO/c1-7-12-19(13-11-16(3)4)15-17(5)18(8-2)10-9-14-20-6/h9,14,16H,7-8,10-13,15H2,1-6H3/b14-9?,18-17+ |
| InChIKey | ULZUPWAEDXJJLG-AFWRXDQLSA-N |
| XLogP | 5.02 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.48 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|