C18H33NO — CID 143491341
3,3-dimethyl-1-[3-[(1E,3E)-octa-1,3-dienoxy]propyl]piperidine (PubChem CID 143491341) has the molecular formula C18H33NO and a molecular weight of 279.47 g/mol. Its IUPAC name is 3,3-dimethyl-1-[3-[(1E,3E)-octa-1,3-dienoxy]propyl]piperidine.
| Compound Name | 3,3-dimethyl-1-[3-[(1E,3E)-octa-1,3-dienoxy]propyl]piperidine |
|---|---|
| PubChem CID | 143491341 |
| Molecular Formula | C18H33NO |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.26 |
| IUPAC Name | 3,3-dimethyl-1-[3-[(1E,3E)-octa-1,3-dienoxy]propyl]piperidine |
| SMILES | CCCC/C=C/C=C/OCCCN1CCCC(C)(C)C1 |
| InChI | InChI=1S/C18H33NO/c1-4-5-6-7-8-9-15-20-16-11-14-19-13-10-12-18(2,3)17-19/h7-9,15H,4-6,10-14,16-17H2,1-3H3/b8-7+,15-9+ |
| InChIKey | BXUAPFJCXYCXMD-WESQECEQSA-N |
| XLogP | 4.78 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|