C18H31NO — CID 89355303
1-[[(1E,3Z,5E)-3,6,7,7-tetramethylocta-1,3,5-trienoxy]methyl]piperidine (PubChem CID 89355303) has the molecular formula C18H31NO and a molecular weight of 277.45 g/mol. Its IUPAC name is 1-[[(1E,3Z,5E)-3,6,7,7-tetramethylocta-1,3,5-trienoxy]methyl]piperidine.
| Compound Name | 1-[[(1E,3Z,5E)-3,6,7,7-tetramethylocta-1,3,5-trienoxy]methyl]piperidine |
|---|---|
| PubChem CID | 89355303 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | 1-[[(1E,3Z,5E)-3,6,7,7-tetramethylocta-1,3,5-trienoxy]methyl]piperidine |
| SMILES | CC(=C/C=C(\C)C(C)(C)C)/C=C/OCN1CCCCC1 |
| InChI | InChI=1S/C18H31NO/c1-16(9-10-17(2)18(3,4)5)11-14-20-15-19-12-7-6-8-13-19/h9-11,14H,6-8,12-13,15H2,1-5H3/b14-11+,16-9-,17-10+ |
| InChIKey | DWFTVSSKNWCERI-NRDFVALHSA-N |
| XLogP | 4.90 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|