About methoxyethane;1-methyl-4-[(2E)-4-methylpenta-2,4-dien-2-yl]piperidine
methoxyethane;1-methyl-4-[(2E)-4-methylpenta-2,4-dien-2-yl]piperidine (PubChem CID 142187254) has the molecular formula C15H29NO
and a molecular weight of 239.40 g/mol. Its IUPAC name is methoxyethane;1-methyl-4-[(2E)-4-methylpenta-2,4-dien-2-yl]piperidine.
Molecular Properties
| Compound Name | methoxyethane;1-methyl-4-[(2E)-4-methylpenta-2,4-dien-2-yl]piperidine |
| PubChem CID | 142187254 |
| Molecular Formula | C15H29NO |
| Molecular Weight | 239.40 g/mol |
| Exact Mass | 239.22 |
| IUPAC Name | methoxyethane;1-methyl-4-[(2E)-4-methylpenta-2,4-dien-2-yl]piperidine |
| SMILES | C=C(C)/C=C(\C)C1CCN(C)CC1.CCOC |
| InChI | InChI=1S/C12H21N.C3H8O/c1-10(2)9-11(3)12-5-7-13(4)8-6-12;1-3-4-2/h9,12H,1,5-8H2,2-4H3;3H2,1-2H3/b11-9+; |
| InChIKey | DTHZICRUXBEDIO-LBEJWNQZSA-N |
| XLogP | 3.50 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze methoxyethane;1-methyl-4-[(2E)-4-methylpenta-2,4-dien-2-yl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxyethane;1-methyl-4-[(2E)-4-methylpenta-2,4-dien-2-yl]piperidine?
The IUPAC name of methoxyethane;1-methyl-4-[(2E)-4-methylpenta-2,4-dien-2-yl]piperidine (CID 142187254) is methoxyethane;1-methyl-4-[(2E)-4-methylpenta-2,4-dien-2-yl]piperidine.
What is the SMILES notation for methoxyethane;1-methyl-4-[(2E)-4-methylpenta-2,4-dien-2-yl]piperidine?
The canonical SMILES for methoxyethane;1-methyl-4-[(2E)-4-methylpenta-2,4-dien-2-yl]piperidine is C=C(C)/C=C(\C)C1CCN(C)CC1.CCOC.
What is the InChIKey of methoxyethane;1-methyl-4-[(2E)-4-methylpenta-2,4-dien-2-yl]piperidine?
The InChIKey is DTHZICRUXBEDIO-LBEJWNQZSA-N. The full InChI is InChI=1S/C12H21N.C3H8O/c1-10(2)9-11(3)12-5-7-13(4)8-6-12;1-3-4-2/h9,12H,1,5-8H2,2-4H3;3H2,1-2H3/b11-9+;.
What are the key properties of methoxyethane;1-methyl-4-[(2E)-4-methylpenta-2,4-dien-2-yl]piperidine?
methoxyethane;1-methyl-4-[(2E)-4-methylpenta-2,4-dien-2-yl]piperidine has a molecular weight of 239.40 g/mol, XLogP of 3.50, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methoxyethane;1-methyl-4-[(2E)-4-methylpenta-2,4-dien-2-yl]piperidine is sourced from PubChem (CID 142187254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).