C25H43NO — CID 163230477
ethane;1-(2-ethenoxyethyl)-3-methyl-5-[(2E,5Z)-4-propan-2-ylidenehepta-2,5-dien-3-yl]-3,6-dihydro-2H-pyridine;prop-1-ene (PubChem CID 163230477) has the molecular formula C25H43NO and a molecular weight of 373.63 g/mol. Its IUPAC name is ethane;1-(2-ethenoxyethyl)-3-methyl-5-[(2E,5Z)-4-propan-2-ylidenehepta-2,5-dien-3-yl]-3,6-dihydro-2H-pyridine;prop-1-ene.
| Compound Name | ethane;1-(2-ethenoxyethyl)-3-methyl-5-[(2E,5Z)-4-propan-2-ylidenehepta-2,5-dien-3-yl]-3,6-dihydro-2H-pyridine;prop-1-ene |
|---|---|
| PubChem CID | 163230477 |
| Molecular Formula | C25H43NO |
| Molecular Weight | 373.63 g/mol |
| Exact Mass | 373.33 |
| IUPAC Name | ethane;1-(2-ethenoxyethyl)-3-methyl-5-[(2E,5Z)-4-propan-2-ylidenehepta-2,5-dien-3-yl]-3,6-dihydro-2H-pyridine;prop-1-ene |
| SMILES | C=CC.C=COCCN1CC(/C(=C/C)C(/C=C\C)=C(C)C)=CC(C)C1.CC |
| InChI | InChI=1S/C20H31NO.C3H6.C2H6/c1-7-10-20(16(4)5)19(8-2)18-13-17(6)14-21(15-18)11-12-22-9-3;1-3-2;1-2/h7-10,13,17H,3,11-12,14-15H2,1-2,4-6H3;3H,1H2,2H3;1-2H3/b10-7-,19-8-;; |
| InChIKey | AMJDZJLBJCIXRN-HKIHEVEISA-N |
| XLogP | 7.10 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.63 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|