C16H31NO — CID 143432972
ethane;(5Z)-N-(2-methoxyethyl)-N,3-dimethyl-4-methylideneocta-5,7-dien-1-amine (PubChem CID 143432972) has the molecular formula C16H31NO and a molecular weight of 253.43 g/mol. Its IUPAC name is ethane;(5Z)-N-(2-methoxyethyl)-N,3-dimethyl-4-methylideneocta-5,7-dien-1-amine.
| Compound Name | ethane;(5Z)-N-(2-methoxyethyl)-N,3-dimethyl-4-methylideneocta-5,7-dien-1-amine |
|---|---|
| PubChem CID | 143432972 |
| Molecular Formula | C16H31NO |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.24 |
| IUPAC Name | ethane;(5Z)-N-(2-methoxyethyl)-N,3-dimethyl-4-methylideneocta-5,7-dien-1-amine |
| SMILES | C=C/C=C\C(=C)C(C)CCN(C)CCOC.CC |
| InChI | InChI=1S/C14H25NO.C2H6/c1-6-7-8-13(2)14(3)9-10-15(4)11-12-16-5;1-2/h6-8,14H,1-2,9-12H2,3-5H3;1-2H3/b8-7-; |
| InChIKey | GCEWMQILDIDNHS-CFYXSCKTSA-N |
| XLogP | 3.92 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|