C17H31NO — CID 123365734
N-ethyl-2-methoxy-N-[[1-(4-methylhepta-1,3-dienyl)cyclopropyl]methyl]ethanamine (PubChem CID 123365734) has the molecular formula C17H31NO and a molecular weight of 265.44 g/mol. Its IUPAC name is N-ethyl-2-methoxy-N-[[1-(4-methylhepta-1,3-dienyl)cyclopropyl]methyl]ethanamine.
| Compound Name | N-ethyl-2-methoxy-N-[[1-(4-methylhepta-1,3-dienyl)cyclopropyl]methyl]ethanamine |
|---|---|
| PubChem CID | 123365734 |
| Molecular Formula | C17H31NO |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.24 |
| IUPAC Name | N-ethyl-2-methoxy-N-[[1-(4-methylhepta-1,3-dienyl)cyclopropyl]methyl]ethanamine |
| SMILES | CCCC(C)=CC=CC1(CN(CC)CCOC)CC1 |
| InChI | InChI=1S/C17H31NO/c1-5-8-16(3)9-7-10-17(11-12-17)15-18(6-2)13-14-19-4/h7,9-10H,5-6,8,11-15H2,1-4H3 |
| InChIKey | VDAUDLPPOBSIPU-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|