C16H22INO — CID 144651711
(4Z)-N-iodo-N-(2-methoxyethyl)-4-(6-methylidenecyclohexa-2,4-dien-1-ylidene)hex-5-en-1-amine (PubChem CID 144651711) has the molecular formula C16H22INO and a molecular weight of 371.26 g/mol. Its IUPAC name is (4Z)-N-iodo-N-(2-methoxyethyl)-4-(6-methylidenecyclohexa-2,4-dien-1-ylidene)hex-5-en-1-amine.
| Compound Name | (4Z)-N-iodo-N-(2-methoxyethyl)-4-(6-methylidenecyclohexa-2,4-dien-1-ylidene)hex-5-en-1-amine |
|---|---|
| PubChem CID | 144651711 |
| Molecular Formula | C16H22INO |
| Molecular Weight | 371.26 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | (4Z)-N-iodo-N-(2-methoxyethyl)-4-(6-methylidenecyclohexa-2,4-dien-1-ylidene)hex-5-en-1-amine |
| SMILES | C=C/C(CCCN(I)CCOC)=c1/ccccc1=C |
| InChI | InChI=1S/C16H22INO/c1-4-15(16-10-6-5-8-14(16)2)9-7-11-18(17)12-13-19-3/h4-6,8,10H,1-2,7,9,11-13H2,3H3/b16-15+ |
| InChIKey | CNEXAXIQZOKAET-FOCLMDBBSA-N |
| XLogP | 2.51 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.26 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|