C16H29NO — CID 145280023
(4E)-4-ethenyl-N,3-diethyl-N-(2-methoxyethyl)hepta-4,6-dien-1-amine (PubChem CID 145280023) has the molecular formula C16H29NO and a molecular weight of 251.41 g/mol. Its IUPAC name is (4E)-4-ethenyl-N,3-diethyl-N-(2-methoxyethyl)hepta-4,6-dien-1-amine.
| Compound Name | (4E)-4-ethenyl-N,3-diethyl-N-(2-methoxyethyl)hepta-4,6-dien-1-amine |
|---|---|
| PubChem CID | 145280023 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | (4E)-4-ethenyl-N,3-diethyl-N-(2-methoxyethyl)hepta-4,6-dien-1-amine |
| SMILES | C=C/C=C(\C=C)C(CC)CCN(CC)CCOC |
| InChI | InChI=1S/C16H29NO/c1-6-10-15(7-2)16(8-3)11-12-17(9-4)13-14-18-5/h6-7,10,16H,1-2,8-9,11-14H2,3-5H3/b15-10+ |
| InChIKey | SNEHMIXREMNUPF-XNTDXEJSSA-N |
| XLogP | 3.67 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|