C23H31NO — CID 145346171
(3Z,5Z)-5-ethenyl-N-[(4-ethenylcyclohepta-1,3,5-trien-1-yl)methyl]-N-(2-methoxyethyl)octa-3,5,7-trien-1-amine (PubChem CID 145346171) has the molecular formula C23H31NO and a molecular weight of 337.51 g/mol. Its IUPAC name is (3Z,5Z)-5-ethenyl-N-[(4-ethenylcyclohepta-1,3,5-trien-1-yl)methyl]-N-(2-methoxyethyl)octa-3,5,7-trien-1-amine.
| Compound Name | (3Z,5Z)-5-ethenyl-N-[(4-ethenylcyclohepta-1,3,5-trien-1-yl)methyl]-N-(2-methoxyethyl)octa-3,5,7-trien-1-amine |
|---|---|
| PubChem CID | 145346171 |
| Molecular Formula | C23H31NO |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | (3Z,5Z)-5-ethenyl-N-[(4-ethenylcyclohepta-1,3,5-trien-1-yl)methyl]-N-(2-methoxyethyl)octa-3,5,7-trien-1-amine |
| SMILES | C=C/C=C(C=C)\C=C/CCN(CCOC)CC1=CC=C(C=C)C=CC1 |
| InChI | InChI=1S/C23H31NO/c1-5-11-21(6-2)12-8-9-17-24(18-19-25-4)20-23-14-10-13-22(7-3)15-16-23/h5-8,10-13,15-16H,1-3,9,14,17-20H2,4H3/b12-8-,21-11- |
| InChIKey | CITHFPOPQJQBLT-JPJQNZTRSA-N |
| XLogP | 5.18 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|