C16H27NO — CID 123822583
4-(2-ethylbut-2-enyl)-2-hexa-2,4-dien-3-ylmorpholine (PubChem CID 123822583) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is 4-(2-ethylbut-2-enyl)-2-hexa-2,4-dien-3-ylmorpholine.
| Compound Name | 4-(2-ethylbut-2-enyl)-2-hexa-2,4-dien-3-ylmorpholine |
|---|---|
| PubChem CID | 123822583 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | 4-(2-ethylbut-2-enyl)-2-hexa-2,4-dien-3-ylmorpholine |
| SMILES | CC=CC(=CC)C1CN(CC(=CC)CC)CCO1 |
| InChI | InChI=1S/C16H27NO/c1-5-9-15(8-4)16-13-17(10-11-18-16)12-14(6-2)7-3/h5-6,8-9,16H,7,10-13H2,1-4H3 |
| InChIKey | GRRHHINFQMXHMW-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|