C19H33NO2 — CID 142550031
(Z,2Z)-N-butyl-2-(1-methoxyethylidene)-N-[(2E,4Z)-6-methoxyhexa-2,4-dien-3-yl]pent-3-en-1-amine (PubChem CID 142550031) has the molecular formula C19H33NO2 and a molecular weight of 307.48 g/mol. Its IUPAC name is (Z,2Z)-N-butyl-2-(1-methoxyethylidene)-N-[(2E,4Z)-6-methoxyhexa-2,4-dien-3-yl]pent-3-en-1-amine.
| Compound Name | (Z,2Z)-N-butyl-2-(1-methoxyethylidene)-N-[(2E,4Z)-6-methoxyhexa-2,4-dien-3-yl]pent-3-en-1-amine |
|---|---|
| PubChem CID | 142550031 |
| Molecular Formula | C19H33NO2 |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.25 |
| IUPAC Name | (Z,2Z)-N-butyl-2-(1-methoxyethylidene)-N-[(2E,4Z)-6-methoxyhexa-2,4-dien-3-yl]pent-3-en-1-amine |
| SMILES | C/C=C\C(CN(CCCC)C(/C=C\COC)=C/C)=C(/C)OC |
| InChI | InChI=1S/C19H33NO2/c1-7-10-14-20(19(9-3)13-11-15-21-5)16-18(12-8-2)17(4)22-6/h8-9,11-13H,7,10,14-16H2,1-6H3/b12-8-,13-11-,18-17-,19-9+ |
| InChIKey | SLYYPMJXPAVWSM-QRKINUDTSA-N |
| XLogP | 4.69 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|