C13H23NO — CID 123491650
4-methoxy-N,3-dimethyl-N-penta-1,3-dien-2-ylpent-3-en-1-amine (PubChem CID 123491650) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is 4-methoxy-N,3-dimethyl-N-penta-1,3-dien-2-ylpent-3-en-1-amine.
| Compound Name | 4-methoxy-N,3-dimethyl-N-penta-1,3-dien-2-ylpent-3-en-1-amine |
|---|---|
| PubChem CID | 123491650 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 4-methoxy-N,3-dimethyl-N-penta-1,3-dien-2-ylpent-3-en-1-amine |
| SMILES | C=C(C=CC)N(C)CCC(C)=C(C)OC |
| InChI | InChI=1S/C13H23NO/c1-7-8-12(3)14(5)10-9-11(2)13(4)15-6/h7-8H,3,9-10H2,1-2,4-6H3 |
| InChIKey | LONQZLIJADJMQH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|