C12H19NO — CID 123581075
N-(1-methoxyethenyl)-N,2-dimethylhepta-1,3,5-trien-3-amine (PubChem CID 123581075) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is N-(1-methoxyethenyl)-N,2-dimethylhepta-1,3,5-trien-3-amine.
| Compound Name | N-(1-methoxyethenyl)-N,2-dimethylhepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 123581075 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | N-(1-methoxyethenyl)-N,2-dimethylhepta-1,3,5-trien-3-amine |
| SMILES | C=C(C)C(=CC=CC)N(C)C(=C)OC |
| InChI | InChI=1S/C12H19NO/c1-7-8-9-12(10(2)3)13(5)11(4)14-6/h7-9H,2,4H2,1,3,5-6H3 |
| InChIKey | FIFIUIFTPGJXJJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|