C12H21NO — CID 123792144
N-ethyl-6-methoxy-N-methyl-4-methylidenehepta-2,5-dien-2-amine (PubChem CID 123792144) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is N-ethyl-6-methoxy-N-methyl-4-methylidenehepta-2,5-dien-2-amine.
| Compound Name | N-ethyl-6-methoxy-N-methyl-4-methylidenehepta-2,5-dien-2-amine |
|---|---|
| PubChem CID | 123792144 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | N-ethyl-6-methoxy-N-methyl-4-methylidenehepta-2,5-dien-2-amine |
| SMILES | C=C(C=C(C)OC)C=C(C)N(C)CC |
| InChI | InChI=1S/C12H21NO/c1-7-13(5)11(3)8-10(2)9-12(4)14-6/h8-9H,2,7H2,1,3-6H3 |
| InChIKey | JMTRUZMWDZQGBF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|