C14H29NO — CID 156750960
ethane;(2E,4Z)-N-(2-methoxyethyl)-N,5-dimethylhepta-2,4-dien-2-amine (PubChem CID 156750960) has the molecular formula C14H29NO and a molecular weight of 227.39 g/mol. Its IUPAC name is ethane;(2E,4Z)-N-(2-methoxyethyl)-N,5-dimethylhepta-2,4-dien-2-amine.
| Compound Name | ethane;(2E,4Z)-N-(2-methoxyethyl)-N,5-dimethylhepta-2,4-dien-2-amine |
|---|---|
| PubChem CID | 156750960 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | ethane;(2E,4Z)-N-(2-methoxyethyl)-N,5-dimethylhepta-2,4-dien-2-amine |
| SMILES | CC.CC/C(C)=C\C=C(/C)N(C)CCOC |
| InChI | InChI=1S/C12H23NO.C2H6/c1-6-11(2)7-8-12(3)13(4)9-10-14-5;1-2/h7-8H,6,9-10H2,1-5H3;1-2H3/b11-7-,12-8+; |
| InChIKey | BNHTZDJZFFVGCF-VTYRZUIXSA-N |
| XLogP | 3.85 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|