C12H18F3NO — CID 143942292
(3E)-N-(2-methoxyethyl)-N,5-dimethyl-4-(trifluoromethyl)hexa-1,3,5-trien-2-amine (PubChem CID 143942292) has the molecular formula C12H18F3NO and a molecular weight of 249.28 g/mol. Its IUPAC name is (3E)-N-(2-methoxyethyl)-N,5-dimethyl-4-(trifluoromethyl)hexa-1,3,5-trien-2-amine.
| Compound Name | (3E)-N-(2-methoxyethyl)-N,5-dimethyl-4-(trifluoromethyl)hexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 143942292 |
| Molecular Formula | C12H18F3NO |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | (3E)-N-(2-methoxyethyl)-N,5-dimethyl-4-(trifluoromethyl)hexa-1,3,5-trien-2-amine |
| SMILES | C=C(C)/C(=C\C(=C)N(C)CCOC)C(F)(F)F |
| InChI | InChI=1S/C12H18F3NO/c1-9(2)11(12(13,14)15)8-10(3)16(4)6-7-17-5/h8H,1,3,6-7H2,2,4-5H3/b11-8+ |
| InChIKey | PCFANRYRWPWMNH-DHZHZOJOSA-N |
| XLogP | 3.14 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|