C14H24F3NO — CID 143942291
ethane;(3E)-N-(2-methoxyethyl)-N,5-dimethyl-4-(trifluoromethyl)hexa-1,3,5-trien-2-amine (PubChem CID 143942291) has the molecular formula C14H24F3NO and a molecular weight of 279.35 g/mol. Its IUPAC name is ethane;(3E)-N-(2-methoxyethyl)-N,5-dimethyl-4-(trifluoromethyl)hexa-1,3,5-trien-2-amine.
| Compound Name | ethane;(3E)-N-(2-methoxyethyl)-N,5-dimethyl-4-(trifluoromethyl)hexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 143942291 |
| Molecular Formula | C14H24F3NO |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | ethane;(3E)-N-(2-methoxyethyl)-N,5-dimethyl-4-(trifluoromethyl)hexa-1,3,5-trien-2-amine |
| SMILES | C=C(C)/C(=C\C(=C)N(C)CCOC)C(F)(F)F.CC |
| InChI | InChI=1S/C12H18F3NO.C2H6/c1-9(2)11(12(13,14)15)8-10(3)16(4)6-7-17-5;1-2/h8H,1,3,6-7H2,2,4-5H3;1-2H3/b11-8+; |
| InChIKey | IBMSGEJOIGEZAO-YGCVIUNWSA-N |
| XLogP | 4.17 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|