C12H19F2NO — CID 143994577
(3E)-4-(difluoromethyl)-N-(2-methoxyethyl)-N,5-dimethylhexa-1,3,5-trien-2-amine (PubChem CID 143994577) has the molecular formula C12H19F2NO and a molecular weight of 231.29 g/mol. Its IUPAC name is (3E)-4-(difluoromethyl)-N-(2-methoxyethyl)-N,5-dimethylhexa-1,3,5-trien-2-amine.
| Compound Name | (3E)-4-(difluoromethyl)-N-(2-methoxyethyl)-N,5-dimethylhexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 143994577 |
| Molecular Formula | C12H19F2NO |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | (3E)-4-(difluoromethyl)-N-(2-methoxyethyl)-N,5-dimethylhexa-1,3,5-trien-2-amine |
| SMILES | C=C(C)/C(=C\C(=C)N(C)CCOC)C(F)F |
| InChI | InChI=1S/C12H19F2NO/c1-9(2)11(12(13)14)8-10(3)15(4)6-7-16-5/h8,12H,1,3,6-7H2,2,4-5H3/b11-8+ |
| InChIKey | FSZRPVKPJBSOLN-DHZHZOJOSA-N |
| XLogP | 2.85 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|