C13H19N — CID 135243145
(3Z,6Z,8Z)-N,N-dimethyl-5-methylidenedeca-1,3,6,8-tetraen-4-amine (PubChem CID 135243145) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is (3Z,6Z,8Z)-N,N-dimethyl-5-methylidenedeca-1,3,6,8-tetraen-4-amine.
| Compound Name | (3Z,6Z,8Z)-N,N-dimethyl-5-methylidenedeca-1,3,6,8-tetraen-4-amine |
|---|---|
| PubChem CID | 135243145 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | (3Z,6Z,8Z)-N,N-dimethyl-5-methylidenedeca-1,3,6,8-tetraen-4-amine |
| SMILES | C=C/C=C(/C(=C)/C=C\C=C/C)N(C)C |
| InChI | InChI=1S/C13H19N/c1-6-8-9-11-12(3)13(10-7-2)14(4)5/h6-11H,2-3H2,1,4-5H3/b8-6-,11-9-,13-10- |
| InChIKey | YNVXRGCFEDJMHS-LPNUQKNFSA-N |
| XLogP | 3.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|