C20H30FNO — CID 143936414
(2E,4Z)-N-[(3Z,5Z)-7-(2-fluoroethoxy)hepta-3,5-dienyl]-4-methyl-N-prop-1-en-2-ylhepta-2,4,6-trien-3-amine (PubChem CID 143936414) has the molecular formula C20H30FNO and a molecular weight of 319.46 g/mol. Its IUPAC name is (2E,4Z)-N-[(3Z,5Z)-7-(2-fluoroethoxy)hepta-3,5-dienyl]-4-methyl-N-prop-1-en-2-ylhepta-2,4,6-trien-3-amine.
| Compound Name | (2E,4Z)-N-[(3Z,5Z)-7-(2-fluoroethoxy)hepta-3,5-dienyl]-4-methyl-N-prop-1-en-2-ylhepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 143936414 |
| Molecular Formula | C20H30FNO |
| Molecular Weight | 319.46 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | (2E,4Z)-N-[(3Z,5Z)-7-(2-fluoroethoxy)hepta-3,5-dienyl]-4-methyl-N-prop-1-en-2-ylhepta-2,4,6-trien-3-amine |
| SMILES | C=C/C=C(C)\C(=C/C)N(CC/C=C\C=C/COCCF)C(=C)C |
| InChI | InChI=1S/C20H30FNO/c1-6-13-19(5)20(7-2)22(18(3)4)15-11-9-8-10-12-16-23-17-14-21/h6-10,12-13H,1,3,11,14-17H2,2,4-5H3/b9-8-,12-10-,19-13-,20-7+ |
| InChIKey | LLOGJAYJRONZJH-VTRPTDGJSA-N |
| XLogP | 5.35 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.46 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|